![[ICO]](/icons/blank.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Sina Moghadam - Nist..> | 2023-12-04 16:38 | 11M | |
| Sina Moghadam - Nist..> | 2023-12-04 16:38 | 4.3M | |
| Pouya Bayati - Hasra..> | 2023-12-04 16:38 | 9.1M | |
| Pouya Bayati - Hasra..> | 2023-12-04 16:38 | 3.7M | |
| Pedram Azad - Harf D..> | 2023-12-04 16:38 | 5.5M | |
| Pedram Azad - Harf D..> | 2023-12-04 16:37 | 2.8M | |
| Old2/ | 2023-12-04 01:59 | - | |
| Old/ | 2023-12-04 01:59 | - | |
| Milad Beheshti - Dok..> | 2023-12-04 16:37 | 7.0M | |
| Milad Beheshti - Dok..> | 2023-12-04 16:37 | 2.9M | |
| Mehdi Amiri - Hey To..> | 2023-12-04 16:38 | 8.5M | |
| Mehdi Amiri - Hey To..> | 2023-12-04 16:37 | 3.5M | |
| Hoorosh Band - Be Ki..> | 2023-12-04 16:37 | 6.1M | |
| Hoorosh Band - Be Ki..> | 2023-12-04 16:37 | 3.1M | |